|
Genipin is an aglycone derived from an iridoid glycoside called geniposide present in fruit of Gardenia jasmindides Ellis. Genipin is an excellent natural cross-linker for proteins, collagen, gelatin, and chitosan cross-linking. It has a low acute toxicity, with LD50 i.v. 382 mg/kg in mice, therefore, much less toxic than glutaraldehyde and many other commonly used synthetic cross-linking regents. It is also used for pharmaceutical purposes, such as choleretic action for liver diseases control. Genipin is available for small and large scale production.  Genipin Structure 
Product ID
| ST080860 | | IUPAC name | Methyl (1R,2R,6S)-2-hydroxy-9-(hydroxymethyl)- 3-oxabicyclo[4.3.0]nona-4,8-diene-5-carboxylate | | Identifiers | | CAS number | [6902-77-8] | | PubChem | 442424 | | SMILES | COC(=O)C1=CO[C@H]([C@H]2[C@@H]1CC=C2CO)O | | Properties | | Molecular formula | C11H14O5 | | Molar mass | 226.226 g/mol | Hydrogen Bonds Donors
| 2 | | Hydrogen Bonds Acceptors | 5 | Rotatable Bonds
| 3 | Polar Surface Area
| 76 | | XLogP | -0.8 | Exact Mass
| 226.084 | MonoIsotopic Mass
| 226.084 | Charge
| 0
| Complexity
| 35 |
Genipin Specification| | Specification | Results | | Appearance: | white crystal powder | | | Purity: | 98% up by HPLC method | 98.2% | | Solubilities: | soluble in Ethanol, Methanol, Acetone, slightly soluble in
water | | | Total plate count: | below 1000 CFU/g | 300 CFU/g | | E. coli: | Negative | Negative | | Salmonella: | Negative | Negative | | Storage: | Room temperature | | | | | |
Notice: It can be dissolved in Ethanol first, then diluted to suitable concentration with
buffer solution. |
